C23H30ClN3O3S — CID 68950856
1-(4-chlorophenyl)sulfonyl-3-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]urea (PubChem CID 68950856) has the molecular formula C23H30ClN3O3S and a molecular weight of 464.03 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-3-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]urea.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-3-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]urea |
|---|---|
| PubChem CID | 68950856 |
| Molecular Formula | C23H30ClN3O3S |
| Molecular Weight | 464.03 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-3-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]urea |
| SMILES | CC(CC1CCCCC1)NCc1ccccc1NC(=O)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H30ClN3O3S/c1-17(15-18-7-3-2-4-8-18)25-16-19-9-5-6-10-22(19)26-23(28)27-31(29,30)21-13-11-20(24)12-14-21/h5-6,9-14,17-18,25H,2-4,7-8,15-16H2,1H3,(H2,26,27,28) |
| InChIKey | PAUHKONVQPILCQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.03 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |