C23H31ClN4O2S — CID 87633952
2-(4-chlorophenyl)sulfonyl-1-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]guanidine (PubChem CID 87633952) has the molecular formula C23H31ClN4O2S and a molecular weight of 463.05 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-1-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]guanidine.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-1-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]guanidine |
|---|---|
| PubChem CID | 87633952 |
| Molecular Formula | C23H31ClN4O2S |
| Molecular Weight | 463.05 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-1-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]guanidine |
| SMILES | CC(CC1CCCCC1)NCc1ccccc1N/C(N)=N/S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H31ClN4O2S/c1-17(15-18-7-3-2-4-8-18)26-16-19-9-5-6-10-22(19)27-23(25)28-31(29,30)21-13-11-20(24)12-14-21/h5-6,9-14,17-18,26H,2-4,7-8,15-16H2,1H3,(H3,25,27,28) |
| InChIKey | ITNHOXJMMPPODC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.05 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|