C31H47N3O3S — CID 68951708
N-[4-[[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]sulfamoyl]phenyl]nonanamide (PubChem CID 68951708) has the molecular formula C31H47N3O3S and a molecular weight of 541.80 g/mol. Its IUPAC name is N-[4-[[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]sulfamoyl]phenyl]nonanamide.
| Compound Name | N-[4-[[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]sulfamoyl]phenyl]nonanamide |
|---|---|
| PubChem CID | 68951708 |
| Molecular Formula | C31H47N3O3S |
| Molecular Weight | 541.80 g/mol |
| Exact Mass | 541.33 |
| IUPAC Name | N-[4-[[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]sulfamoyl]phenyl]nonanamide |
| SMILES | CCCCCCCCC(=O)Nc1ccc(S(=O)(=O)Nc2ccccc2CNC(C)CC2CCCCC2)cc1 |
| InChI | InChI=1S/C31H47N3O3S/c1-3-4-5-6-7-11-18-31(35)33-28-19-21-29(22-20-28)38(36,37)34-30-17-13-12-16-27(30)24-32-25(2)23-26-14-9-8-10-15-26/h12-13,16-17,19-22,25-26,32,34H,3-11,14-15,18,23-24H2,1-2H3,(H,33,35) |
| InChIKey | XSFSCVCATRWZHD-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.80 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|