C23H29N3O3S2 — CID 68951712
N-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-sulfonamide (PubChem CID 68951712) has the molecular formula C23H29N3O3S2 and a molecular weight of 459.64 g/mol. Its IUPAC name is N-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-sulfonamide.
| Compound Name | N-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 68951712 |
| Molecular Formula | C23H29N3O3S2 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-[2-[(1-cyclohexylpropan-2-ylamino)methyl]phenyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-sulfonamide |
| SMILES | CC(CC1CCCCC1)NCc1ccccc1NS(=O)(=O)c1ccc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C23H29N3O3S2/c1-16(13-17-7-3-2-4-8-17)24-15-18-9-5-6-10-20(18)26-31(27,28)19-11-12-21-22(14-19)29-23(30)25-21/h5-6,9-12,14,16-17,24,26H,2-4,7-8,13,15H2,1H3,(H,25,30) |
| InChIKey | DQEYCCPRUWJQDT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|