C24H33N3O3S — CID 68950031
1-(1-cyclohexylpropan-2-yl)-3-[[2-[(4-methylphenyl)sulfonylamino]phenyl]methyl]urea (PubChem CID 68950031) has the molecular formula C24H33N3O3S and a molecular weight of 443.61 g/mol. Its IUPAC name is 1-(1-cyclohexylpropan-2-yl)-3-[[2-[(4-methylphenyl)sulfonylamino]phenyl]methyl]urea.
| Compound Name | 1-(1-cyclohexylpropan-2-yl)-3-[[2-[(4-methylphenyl)sulfonylamino]phenyl]methyl]urea |
|---|---|
| PubChem CID | 68950031 |
| Molecular Formula | C24H33N3O3S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 1-(1-cyclohexylpropan-2-yl)-3-[[2-[(4-methylphenyl)sulfonylamino]phenyl]methyl]urea |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2CNC(=O)NC(C)CC2CCCCC2)cc1 |
| InChI | InChI=1S/C24H33N3O3S/c1-18-12-14-22(15-13-18)31(29,30)27-23-11-7-6-10-21(23)17-25-24(28)26-19(2)16-20-8-4-3-5-9-20/h6-7,10-15,19-20,27H,3-5,8-9,16-17H2,1-2H3,(H2,25,26,28) |
| InChIKey | PGFUGYZUKLMGQI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |