C25H22N2O3S — CID 58968977
5-N-(3,3-diphenylpropyl)-2-N-hydroxy-1-benzothiophene-2,5-dicarboxamide (PubChem CID 58968977) has the molecular formula C25H22N2O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is 5-N-(3,3-diphenylpropyl)-2-N-hydroxy-1-benzothiophene-2,5-dicarboxamide.
| Compound Name | 5-N-(3,3-diphenylpropyl)-2-N-hydroxy-1-benzothiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 58968977 |
| Molecular Formula | C25H22N2O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 5-N-(3,3-diphenylpropyl)-2-N-hydroxy-1-benzothiophene-2,5-dicarboxamide |
| SMILES | O=C(NCCC(c1ccccc1)c1ccccc1)c1ccc2sc(C(=O)NO)cc2c1 |
| InChI | InChI=1S/C25H22N2O3S/c28-24(19-11-12-22-20(15-19)16-23(31-22)25(29)27-30)26-14-13-21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-12,15-16,21,30H,13-14H2,(H,26,28)(H,27,29) |
| InChIKey | PQDWKEYTSDLHPF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|