C24H20N2O3S — CID 58968905
6-N-(1,2-diphenylethyl)-2-N-hydroxy-1-benzothiophene-2,6-dicarboxamide (PubChem CID 58968905) has the molecular formula C24H20N2O3S and a molecular weight of 416.50 g/mol. Its IUPAC name is 6-N-(1,2-diphenylethyl)-2-N-hydroxy-1-benzothiophene-2,6-dicarboxamide.
| Compound Name | 6-N-(1,2-diphenylethyl)-2-N-hydroxy-1-benzothiophene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 58968905 |
| Molecular Formula | C24H20N2O3S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 6-N-(1,2-diphenylethyl)-2-N-hydroxy-1-benzothiophene-2,6-dicarboxamide |
| SMILES | O=C(NC(Cc1ccccc1)c1ccccc1)c1ccc2cc(C(=O)NO)sc2c1 |
| InChI | InChI=1S/C24H20N2O3S/c27-23(19-12-11-18-14-22(24(28)26-29)30-21(18)15-19)25-20(17-9-5-2-6-10-17)13-16-7-3-1-4-8-16/h1-12,14-15,20,29H,13H2,(H,25,27)(H,26,28) |
| InChIKey | KABOWTXMUMSIPT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|