C28H25NO3S — CID 55773574
3-(benzenesulfonylmethyl)-N-(1,2-diphenylethyl)benzamide (PubChem CID 55773574) has the molecular formula C28H25NO3S and a molecular weight of 455.58 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-(1,2-diphenylethyl)benzamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-(1,2-diphenylethyl)benzamide |
|---|---|
| PubChem CID | 55773574 |
| Molecular Formula | C28H25NO3S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-(1,2-diphenylethyl)benzamide |
| SMILES | O=C(NC(Cc1ccccc1)c1ccccc1)c1cccc(CS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C28H25NO3S/c30-28(29-27(24-14-6-2-7-15-24)20-22-11-4-1-5-12-22)25-16-10-13-23(19-25)21-33(31,32)26-17-8-3-9-18-26/h1-19,27H,20-21H2,(H,29,30) |
| InChIKey | PBZOUWCOSPHQSI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |