C18H17NO5S2 — CID 100741201
3-(benzenesulfonylmethyl)-N-but-3-ynylsulfonylbenzamide (PubChem CID 100741201) has the molecular formula C18H17NO5S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-but-3-ynylsulfonylbenzamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-but-3-ynylsulfonylbenzamide |
|---|---|
| PubChem CID | 100741201 |
| Molecular Formula | C18H17NO5S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-but-3-ynylsulfonylbenzamide |
| SMILES | C#CCCS(=O)(=O)NC(=O)c1cccc(CS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H17NO5S2/c1-2-3-12-26(23,24)19-18(20)16-9-7-8-15(13-16)14-25(21,22)17-10-5-4-6-11-17/h1,4-11,13H,3,12,14H2,(H,19,20) |
| InChIKey | PKMITUCHJYJHHL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|