C21H25NO5S — CID 26975678
propan-2-yl (3R)-3-[[3-(methylsulfonylmethyl)benzoyl]amino]-3-phenylpropanoate (PubChem CID 26975678) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is propan-2-yl (3R)-3-[[3-(methylsulfonylmethyl)benzoyl]amino]-3-phenylpropanoate.
| Compound Name | propan-2-yl (3R)-3-[[3-(methylsulfonylmethyl)benzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 26975678 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | propan-2-yl (3R)-3-[[3-(methylsulfonylmethyl)benzoyl]amino]-3-phenylpropanoate |
| SMILES | CC(C)OC(=O)C[C@@H](NC(=O)c1cccc(CS(C)(=O)=O)c1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO5S/c1-15(2)27-20(23)13-19(17-9-5-4-6-10-17)22-21(24)18-11-7-8-16(12-18)14-28(3,25)26/h4-12,15,19H,13-14H2,1-3H3,(H,22,24)/t19-/m1/s1 |
| InChIKey | XKEBNCGTHSIXPK-LJQANCHMSA-N |
| XLogP | 3.04 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |