C14H15NO — CID 82685199
N-(1,2-diphenylethyl)hydroxylamine (PubChem CID 82685199) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)hydroxylamine.
| Compound Name | N-(1,2-diphenylethyl)hydroxylamine |
|---|---|
| PubChem CID | 82685199 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | N-(1,2-diphenylethyl)hydroxylamine |
| SMILES | ONC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H15NO/c16-15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10,14-16H,11H2 |
| InChIKey | XOWLAMHHPIHXRG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|