C17H21NO — CID 114986946
(2R)-2-(1,2-diphenylethylamino)propan-1-ol (PubChem CID 114986946) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is (2R)-2-(1,2-diphenylethylamino)propan-1-ol.
| Compound Name | (2R)-2-(1,2-diphenylethylamino)propan-1-ol |
|---|---|
| PubChem CID | 114986946 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (2R)-2-(1,2-diphenylethylamino)propan-1-ol |
| SMILES | C[C@H](CO)NC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H21NO/c1-14(13-19)18-17(16-10-6-3-7-11-16)12-15-8-4-2-5-9-15/h2-11,14,17-19H,12-13H2,1H3/t14-,17?/m1/s1 |
| InChIKey | GRCWULRRKAJPKL-XPCCGILXSA-N |
| XLogP | 2.94 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |