C19H18N2OS — CID 52529905
N-[(1R)-1,2-diphenylethyl]-2-methyl-1,3-thiazole-5-carboxamide (PubChem CID 52529905) has the molecular formula C19H18N2OS and a molecular weight of 322.43 g/mol. Its IUPAC name is N-[(1R)-1,2-diphenylethyl]-2-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1R)-1,2-diphenylethyl]-2-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 52529905 |
| Molecular Formula | C19H18N2OS |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-[(1R)-1,2-diphenylethyl]-2-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncc(C(=O)N[C@H](Cc2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C19H18N2OS/c1-14-20-13-18(23-14)19(22)21-17(16-10-6-3-7-11-16)12-15-8-4-2-5-9-15/h2-11,13,17H,12H2,1H3,(H,21,22)/t17-/m1/s1 |
| InChIKey | AIYNCEICPKBLHD-QGZVFWFLSA-N |
| XLogP | 4.17 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |