C19H18N2O2 — CID 31348831
N-[(1R)-1,2-diphenylethyl]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 31348831) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-[(1R)-1,2-diphenylethyl]-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(1R)-1,2-diphenylethyl]-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 31348831 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-[(1R)-1,2-diphenylethyl]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@H](Cc2ccccc2)c2ccccc2)no1 |
| InChI | InChI=1S/C19H18N2O2/c1-14-12-18(21-23-14)19(22)20-17(16-10-6-3-7-11-16)13-15-8-4-2-5-9-15/h2-12,17H,13H2,1H3,(H,20,22)/t17-/m1/s1 |
| InChIKey | HKKRCPGRTGZLPA-QGZVFWFLSA-N |
| XLogP | 3.70 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |