C13H13ClN2O2 — CID 113271445
N-(2-chloro-2-phenylethyl)-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 113271445) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is N-(2-chloro-2-phenylethyl)-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-chloro-2-phenylethyl)-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 113271445 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-(2-chloro-2-phenylethyl)-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(Cl)c2ccccc2)no1 |
| InChI | InChI=1S/C13H13ClN2O2/c1-9-7-12(16-18-9)13(17)15-8-11(14)10-5-3-2-4-6-10/h2-7,11H,8H2,1H3,(H,15,17) |
| InChIKey | YZWKMKAJJAFOSG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|