C9H11BrN2O4 — CID 103492671
methyl 2-bromo-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]propanoate (PubChem CID 103492671) has the molecular formula C9H11BrN2O4 and a molecular weight of 291.10 g/mol. Its IUPAC name is methyl 2-bromo-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]propanoate.
| Compound Name | methyl 2-bromo-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 103492671 |
| Molecular Formula | C9H11BrN2O4 |
| Molecular Weight | 291.10 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | methyl 2-bromo-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(Br)CNC(=O)c1cc(C)on1 |
| InChI | InChI=1S/C9H11BrN2O4/c1-5-3-7(12-16-5)8(13)11-4-6(10)9(14)15-2/h3,6H,4H2,1-2H3,(H,11,13) |
| InChIKey | KZBWNXDBWNHUOV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.10 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|