C10H14N2O4 — CID 14676597
ethyl 2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]propanoate (PubChem CID 14676597) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is ethyl 2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]propanoate.
| Compound Name | ethyl 2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 14676597 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | ethyl 2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)c1cc(C)on1 |
| InChI | InChI=1S/C10H14N2O4/c1-4-15-10(14)7(3)11-9(13)8-5-6(2)16-12-8/h5,7H,4H2,1-3H3,(H,11,13) |
| InChIKey | YZDOEUXFEIHNOS-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |