C24H26N4O6 — CID 10695509
ethyl (2S)-2-[[9-[[(2S)-1-ethoxy-1-oxopropan-2-yl]carbamoyl]-1,10-phenanthroline-2-carbonyl]amino]propanoate (PubChem CID 10695509) has the molecular formula C24H26N4O6 and a molecular weight of 466.49 g/mol. Its IUPAC name is ethyl (2S)-2-[[9-[[(2S)-1-ethoxy-1-oxopropan-2-yl]carbamoyl]-1,10-phenanthroline-2-carbonyl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[9-[[(2S)-1-ethoxy-1-oxopropan-2-yl]carbamoyl]-1,10-phenanthroline-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 10695509 |
| Molecular Formula | C24H26N4O6 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | ethyl (2S)-2-[[9-[[(2S)-1-ethoxy-1-oxopropan-2-yl]carbamoyl]-1,10-phenanthroline-2-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NC(=O)c1ccc2ccc3ccc(C(=O)N[C@@H](C)C(=O)OCC)nc3c2n1 |
| InChI | InChI=1S/C24H26N4O6/c1-5-33-23(31)13(3)25-21(29)17-11-9-15-7-8-16-10-12-18(28-20(16)19(15)27-17)22(30)26-14(4)24(32)34-6-2/h7-14H,5-6H2,1-4H3,(H,25,29)(H,26,30)/t13-,14-/m0/s1 |
| InChIKey | YOFYXQRKECAVHF-KBPBESRZSA-N |
| XLogP | 2.15 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|