C10H16N2O4 — CID 66157155
N-(1,1-dimethoxypropan-2-yl)-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 66157155) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is N-(1,1-dimethoxypropan-2-yl)-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(1,1-dimethoxypropan-2-yl)-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 66157155 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | N-(1,1-dimethoxypropan-2-yl)-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | COC(OC)C(C)NC(=O)c1cc(C)on1 |
| InChI | InChI=1S/C10H16N2O4/c1-6-5-8(12-16-6)9(13)11-7(2)10(14-3)15-4/h5,7,10H,1-4H3,(H,11,13) |
| InChIKey | NMDXTXGGJGWTEI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|