C9H10N2O6 — CID 112732912
(2S)-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]butanedioic acid (PubChem CID 112732912) has the molecular formula C9H10N2O6 and a molecular weight of 242.19 g/mol. Its IUPAC name is (2S)-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]butanedioic acid.
| Compound Name | (2S)-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 112732912 |
| Molecular Formula | C9H10N2O6 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (2S)-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]butanedioic acid |
| SMILES | Cc1cc(C(=O)N[C@@H](CC(=O)O)C(=O)O)no1 |
| InChI | InChI=1S/C9H10N2O6/c1-4-2-5(11-17-4)8(14)10-6(9(15)16)3-7(12)13/h2,6H,3H2,1H3,(H,10,14)(H,12,13)(H,15,16)/t6-/m0/s1 |
| InChIKey | PASWOJGTBWDBRY-LURJTMIESA-N |
| XLogP | -0.36 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |