C11H14N2O4 — CID 120692636
(E)-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]hex-4-enoic acid (PubChem CID 120692636) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is (E)-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]hex-4-enoic acid.
| Compound Name | (E)-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120692636 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (E)-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1cc(C)on1)C(=O)O |
| InChI | InChI=1S/C11H14N2O4/c1-3-4-5-8(11(15)16)12-10(14)9-6-7(2)17-13-9/h3-4,6,8H,5H2,1-2H3,(H,12,14)(H,15,16)/b4-3+ |
| InChIKey | HWGALQFEQQSVLV-ONEGZZNKSA-N |
| XLogP | 1.13 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|