C14H15N3O3 — CID 120694040
(E)-2-[(5-cyano-6-methylpyridine-2-carbonyl)amino]hex-4-enoic acid (PubChem CID 120694040) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is (E)-2-[(5-cyano-6-methylpyridine-2-carbonyl)amino]hex-4-enoic acid.
| Compound Name | (E)-2-[(5-cyano-6-methylpyridine-2-carbonyl)amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120694040 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | (E)-2-[(5-cyano-6-methylpyridine-2-carbonyl)amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1ccc(C#N)c(C)n1)C(=O)O |
| InChI | InChI=1S/C14H15N3O3/c1-3-4-5-12(14(19)20)17-13(18)11-7-6-10(8-15)9(2)16-11/h3-4,6-7,12H,5H2,1-2H3,(H,17,18)(H,19,20)/b4-3+ |
| InChIKey | PVDXRFLSXJVNHM-ONEGZZNKSA-N |
| XLogP | 1.41 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|