C15H17N3O4 — CID 120694047
(E)-2-[[5-(5-methylfuran-2-yl)-1H-pyrazole-3-carbonyl]amino]hex-4-enoic acid (PubChem CID 120694047) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is (E)-2-[[5-(5-methylfuran-2-yl)-1H-pyrazole-3-carbonyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[5-(5-methylfuran-2-yl)-1H-pyrazole-3-carbonyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120694047 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (E)-2-[[5-(5-methylfuran-2-yl)-1H-pyrazole-3-carbonyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1cc(-c2ccc(C)o2)[nH]n1)C(=O)O |
| InChI | InChI=1S/C15H17N3O4/c1-3-4-5-10(15(20)21)16-14(19)12-8-11(17-18-12)13-7-6-9(2)22-13/h3-4,6-8,10H,5H2,1-2H3,(H,16,19)(H,17,18)(H,20,21)/b4-3+ |
| InChIKey | MWTMWLQLIGQQBD-ONEGZZNKSA-N |
| XLogP | 2.13 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|