C13H19ClN4O2 — CID 119434158
N-[3-(methylamino)propyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide;hydrochloride (PubChem CID 119434158) has the molecular formula C13H19ClN4O2 and a molecular weight of 298.77 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-[3-(methylamino)propyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119434158 |
| Molecular Formula | C13H19ClN4O2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N-[3-(methylamino)propyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide;hydrochloride |
| SMILES | CNCCCNC(=O)c1cc(-c2ccc(C)o2)[nH]n1.Cl |
| InChI | InChI=1S/C13H18N4O2.ClH/c1-9-4-5-12(19-9)10-8-11(17-16-10)13(18)15-7-3-6-14-2;/h4-5,8,14H,3,6-7H2,1-2H3,(H,15,18)(H,16,17);1H |
| InChIKey | SXKYZQMTWPOJIR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|