C14H12BrN3O2S — CID 112829365
N-[(5-bromothiophen-2-yl)methyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide (PubChem CID 112829365) has the molecular formula C14H12BrN3O2S and a molecular weight of 366.24 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 112829365 |
| Molecular Formula | C14H12BrN3O2S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCc3ccc(Br)s3)n[nH]2)o1 |
| InChI | InChI=1S/C14H12BrN3O2S/c1-8-2-4-12(20-8)10-6-11(18-17-10)14(19)16-7-9-3-5-13(15)21-9/h2-6H,7H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | BHHOHSZCKJDSSY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |