C16H17N3O2S — CID 70715052
5-(5-methylfuran-2-yl)-N-[2-(5-methylthiophen-2-yl)ethyl]-1H-pyrazole-3-carboxamide (PubChem CID 70715052) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 5-(5-methylfuran-2-yl)-N-[2-(5-methylthiophen-2-yl)ethyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(5-methylfuran-2-yl)-N-[2-(5-methylthiophen-2-yl)ethyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 70715052 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 5-(5-methylfuran-2-yl)-N-[2-(5-methylthiophen-2-yl)ethyl]-1H-pyrazole-3-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCCc3ccc(C)s3)n[nH]2)o1 |
| InChI | InChI=1S/C16H17N3O2S/c1-10-3-6-15(21-10)13-9-14(19-18-13)16(20)17-8-7-12-5-4-11(2)22-12/h3-6,9H,7-8H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | WCEDDNDWULIQIA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |