C15H17N5O2S — CID 70715083
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide (PubChem CID 70715083) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 70715083 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-(5-methylfuran-2-yl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCCCc3csc(N)n3)n[nH]2)o1 |
| InChI | InChI=1S/C15H17N5O2S/c1-9-4-5-13(22-9)11-7-12(20-19-11)14(21)17-6-2-3-10-8-23-15(16)18-10/h4-5,7-8H,2-3,6H2,1H3,(H2,16,18)(H,17,21)(H,19,20) |
| InChIKey | ZDDMPEZPEOBCNN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|