C16H16FN5OS — CID 70776210
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-(2-fluorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 70776210) has the molecular formula C16H16FN5OS and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-(2-fluorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-(2-fluorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 70776210 |
| Molecular Formula | C16H16FN5OS |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-(2-fluorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Nc1nc(CCCNC(=O)c2cc(-c3ccccc3F)n[nH]2)cs1 |
| InChI | InChI=1S/C16H16FN5OS/c17-12-6-2-1-5-11(12)13-8-14(22-21-13)15(23)19-7-3-4-10-9-24-16(18)20-10/h1-2,5-6,8-9H,3-4,7H2,(H2,18,20)(H,19,23)(H,21,22) |
| InChIKey | VDPCHVOKVLCYAB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|