C13H13ClFN3OS — CID 91777823
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-chloro-2-fluorobenzamide (PubChem CID 91777823) has the molecular formula C13H13ClFN3OS and a molecular weight of 313.79 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-chloro-2-fluorobenzamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-chloro-2-fluorobenzamide |
|---|---|
| PubChem CID | 91777823 |
| Molecular Formula | C13H13ClFN3OS |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-5-chloro-2-fluorobenzamide |
| SMILES | Nc1nc(CCCNC(=O)c2cc(Cl)ccc2F)cs1 |
| InChI | InChI=1S/C13H13ClFN3OS/c14-8-3-4-11(15)10(6-8)12(19)17-5-1-2-9-7-20-13(16)18-9/h3-4,6-7H,1-2,5H2,(H2,16,18)(H,17,19) |
| InChIKey | XEHKXBWDWUOTDN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|