C14H20N6OS — CID 131918647
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(dimethylamino)-4-methylpyrimidine-5-carboxamide (PubChem CID 131918647) has the molecular formula C14H20N6OS and a molecular weight of 320.42 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(dimethylamino)-4-methylpyrimidine-5-carboxamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(dimethylamino)-4-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 131918647 |
| Molecular Formula | C14H20N6OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-2-(dimethylamino)-4-methylpyrimidine-5-carboxamide |
| SMILES | Cc1nc(N(C)C)ncc1C(=O)NCCCc1csc(N)n1 |
| InChI | InChI=1S/C14H20N6OS/c1-9-11(7-17-14(18-9)20(2)3)12(21)16-6-4-5-10-8-22-13(15)19-10/h7-8H,4-6H2,1-3H3,(H2,15,19)(H,16,21) |
| InChIKey | SKZMQCDSLSTHHN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|