C16H18N6OS2 — CID 154570205
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-ethyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 154570205) has the molecular formula C16H18N6OS2 and a molecular weight of 374.50 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-ethyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-ethyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 154570205 |
| Molecular Formula | C16H18N6OS2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-ethyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | CCc1nc(-c2ncccn2)sc1C(=O)NCCCc1csc(N)n1 |
| InChI | InChI=1S/C16H18N6OS2/c1-2-11-12(25-15(22-11)13-18-7-4-8-19-13)14(23)20-6-3-5-10-9-24-16(17)21-10/h4,7-9H,2-3,5-6H2,1H3,(H2,17,21)(H,20,23) |
| InChIKey | IZZDSBFKHUAMKF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|