C18H17FN4O2S — CID 154567007
4-ethyl-N-[2-(2-fluorophenoxy)ethyl]-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 154567007) has the molecular formula C18H17FN4O2S and a molecular weight of 372.43 g/mol. Its IUPAC name is 4-ethyl-N-[2-(2-fluorophenoxy)ethyl]-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-ethyl-N-[2-(2-fluorophenoxy)ethyl]-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 154567007 |
| Molecular Formula | C18H17FN4O2S |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 4-ethyl-N-[2-(2-fluorophenoxy)ethyl]-2-pyrimidin-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | CCc1nc(-c2ncccn2)sc1C(=O)NCCOc1ccccc1F |
| InChI | InChI=1S/C18H17FN4O2S/c1-2-13-15(26-18(23-13)16-20-8-5-9-21-16)17(24)22-10-11-25-14-7-4-3-6-12(14)19/h3-9H,2,10-11H2,1H3,(H,22,24) |
| InChIKey | NSLQHSGHICSYAI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|