C11H14ClN5OS — CID 131889869
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-chloro-1-methylpyrazole-3-carboxamide (PubChem CID 131889869) has the molecular formula C11H14ClN5OS and a molecular weight of 299.79 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-chloro-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-chloro-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 131889869 |
| Molecular Formula | C11H14ClN5OS |
| Molecular Weight | 299.79 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-chloro-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1cc(Cl)c(C(=O)NCCCc2csc(N)n2)n1 |
| InChI | InChI=1S/C11H14ClN5OS/c1-17-5-8(12)9(16-17)10(18)14-4-2-3-7-6-19-11(13)15-7/h5-6H,2-4H2,1H3,(H2,13,15)(H,14,18) |
| InChIKey | QPJSYHAKAMRDLR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.79 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|