C15H19N3OS — CID 110717824
N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-propan-2-ylbenzamide (PubChem CID 110717824) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 110717824 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-propan-2-ylbenzamide |
| SMILES | CC(C)c1ccc(C(=O)NCCc2csc(N)n2)cc1 |
| InChI | InChI=1S/C15H19N3OS/c1-10(2)11-3-5-12(6-4-11)14(19)17-8-7-13-9-20-15(16)18-13/h3-6,9-10H,7-8H2,1-2H3,(H2,16,18)(H,17,19) |
| InChIKey | YNWAGYOJZGVOMF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |