C15H15N5O3S — CID 72897828
N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-(2,4-dioxoimidazolidin-1-yl)benzamide (PubChem CID 72897828) has the molecular formula C15H15N5O3S and a molecular weight of 345.38 g/mol. Its IUPAC name is N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-(2,4-dioxoimidazolidin-1-yl)benzamide.
| Compound Name | N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-(2,4-dioxoimidazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 72897828 |
| Molecular Formula | C15H15N5O3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-4-(2,4-dioxoimidazolidin-1-yl)benzamide |
| SMILES | Nc1nc(CCNC(=O)c2ccc(N3CC(=O)NC3=O)cc2)cs1 |
| InChI | InChI=1S/C15H15N5O3S/c16-14-18-10(8-24-14)5-6-17-13(22)9-1-3-11(4-2-9)20-7-12(21)19-15(20)23/h1-4,8H,5-7H2,(H2,16,18)(H,17,22)(H,19,21,23) |
| InChIKey | RYOMSSRSJLCMHL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|