C17H15N5O3S — CID 72888492
4-(2,4-dioxoimidazolidin-1-yl)-N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]benzamide (PubChem CID 72888492) has the molecular formula C17H15N5O3S and a molecular weight of 369.41 g/mol. Its IUPAC name is 4-(2,4-dioxoimidazolidin-1-yl)-N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]benzamide.
| Compound Name | 4-(2,4-dioxoimidazolidin-1-yl)-N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]benzamide |
|---|---|
| PubChem CID | 72888492 |
| Molecular Formula | C17H15N5O3S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 4-(2,4-dioxoimidazolidin-1-yl)-N-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl]benzamide |
| SMILES | Cc1csc2nc(CNC(=O)c3ccc(N4CC(=O)NC4=O)cc3)cn12 |
| InChI | InChI=1S/C17H15N5O3S/c1-10-9-26-17-19-12(7-21(10)17)6-18-15(24)11-2-4-13(5-3-11)22-8-14(23)20-16(22)25/h2-5,7,9H,6,8H2,1H3,(H,18,24)(H,20,23,25) |
| InChIKey | AQKQWPWDAKDYJE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|