C16H15N5O3 — CID 74231577
4-(2,4-dioxoimidazolidin-1-yl)-N-[(5-methylpyrazin-2-yl)methyl]benzamide (PubChem CID 74231577) has the molecular formula C16H15N5O3 and a molecular weight of 325.33 g/mol. Its IUPAC name is 4-(2,4-dioxoimidazolidin-1-yl)-N-[(5-methylpyrazin-2-yl)methyl]benzamide.
| Compound Name | 4-(2,4-dioxoimidazolidin-1-yl)-N-[(5-methylpyrazin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 74231577 |
| Molecular Formula | C16H15N5O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-(2,4-dioxoimidazolidin-1-yl)-N-[(5-methylpyrazin-2-yl)methyl]benzamide |
| SMILES | Cc1cnc(CNC(=O)c2ccc(N3CC(=O)NC3=O)cc2)cn1 |
| InChI | InChI=1S/C16H15N5O3/c1-10-6-18-12(7-17-10)8-19-15(23)11-2-4-13(5-3-11)21-9-14(22)20-16(21)24/h2-7H,8-9H2,1H3,(H,19,23)(H,20,22,24) |
| InChIKey | OVKXLCRXZGRLBU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|