C15H15N5O5 — CID 72852410
4-(2,4-dioxoimidazolidin-1-yl)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]benzamide (PubChem CID 72852410) has the molecular formula C15H15N5O5 and a molecular weight of 345.32 g/mol. Its IUPAC name is 4-(2,4-dioxoimidazolidin-1-yl)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]benzamide.
| Compound Name | 4-(2,4-dioxoimidazolidin-1-yl)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]benzamide |
|---|---|
| PubChem CID | 72852410 |
| Molecular Formula | C15H15N5O5 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 4-(2,4-dioxoimidazolidin-1-yl)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]benzamide |
| SMILES | Cc1nonc1OCCNC(=O)c1ccc(N2CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C15H15N5O5/c1-9-14(19-25-18-9)24-7-6-16-13(22)10-2-4-11(5-3-10)20-8-12(21)17-15(20)23/h2-5H,6-8H2,1H3,(H,16,22)(H,17,21,23) |
| InChIKey | MGNRRVLBCNBEMZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|