C13H14N6O3 — CID 157018704
1-methyl-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]pyrazolo[4,5-b]pyridine-6-carboxamide (PubChem CID 157018704) has the molecular formula C13H14N6O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is 1-methyl-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]pyrazolo[4,5-b]pyridine-6-carboxamide.
| Compound Name | 1-methyl-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]pyrazolo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 157018704 |
| Molecular Formula | C13H14N6O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-methyl-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]pyrazolo[4,5-b]pyridine-6-carboxamide |
| SMILES | Cc1nonc1OCCNC(=O)c1cnc2cnn(C)c2c1 |
| InChI | InChI=1S/C13H14N6O3/c1-8-13(18-22-17-8)21-4-3-14-12(20)9-5-11-10(15-6-9)7-16-19(11)2/h5-7H,3-4H2,1-2H3,(H,14,20) |
| InChIKey | TUBQKSDSRFLECN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 107.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|