C13H16N4O3 — CID 156583875
methyl 4-[(1-methylpyrazolo[4,5-b]pyridine-6-carbonyl)amino]butanoate (PubChem CID 156583875) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is methyl 4-[(1-methylpyrazolo[4,5-b]pyridine-6-carbonyl)amino]butanoate.
| Compound Name | methyl 4-[(1-methylpyrazolo[4,5-b]pyridine-6-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 156583875 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | methyl 4-[(1-methylpyrazolo[4,5-b]pyridine-6-carbonyl)amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1cnc2cnn(C)c2c1 |
| InChI | InChI=1S/C13H16N4O3/c1-17-11-6-9(7-15-10(11)8-16-17)13(19)14-5-3-4-12(18)20-2/h6-8H,3-5H2,1-2H3,(H,14,19) |
| InChIKey | HEUDFTLTMNUBLG-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|