C14H21N3O5 — CID 19471172
3-[4-[(6-methoxy-6-oxohexyl)carbamoyl]pyrazol-1-yl]propanoic acid (PubChem CID 19471172) has the molecular formula C14H21N3O5 and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-[4-[(6-methoxy-6-oxohexyl)carbamoyl]pyrazol-1-yl]propanoic acid.
| Compound Name | 3-[4-[(6-methoxy-6-oxohexyl)carbamoyl]pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 19471172 |
| Molecular Formula | C14H21N3O5 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-[4-[(6-methoxy-6-oxohexyl)carbamoyl]pyrazol-1-yl]propanoic acid |
| SMILES | COC(=O)CCCCCNC(=O)c1cnn(CCC(=O)O)c1 |
| InChI | InChI=1S/C14H21N3O5/c1-22-13(20)5-3-2-4-7-15-14(21)11-9-16-17(10-11)8-6-12(18)19/h9-10H,2-8H2,1H3,(H,15,21)(H,18,19) |
| InChIKey | OLZCHNBQCFLMFP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|