C10H13N3O3 — CID 110488353
methyl 3-[(5-aminopyridine-3-carbonyl)amino]propanoate (PubChem CID 110488353) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is methyl 3-[(5-aminopyridine-3-carbonyl)amino]propanoate.
| Compound Name | methyl 3-[(5-aminopyridine-3-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 110488353 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | methyl 3-[(5-aminopyridine-3-carbonyl)amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1cncc(N)c1 |
| InChI | InChI=1S/C10H13N3O3/c1-16-9(14)2-3-13-10(15)7-4-8(11)6-12-5-7/h4-6H,2-3,11H2,1H3,(H,13,15) |
| InChIKey | UCXYJQDCOLOSBX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |