C14H24N4O3 — CID 72891115
N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-3-(1-methylpiperidin-2-yl)propanamide (PubChem CID 72891115) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-3-(1-methylpiperidin-2-yl)propanamide.
| Compound Name | N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-3-(1-methylpiperidin-2-yl)propanamide |
|---|---|
| PubChem CID | 72891115 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-3-(1-methylpiperidin-2-yl)propanamide |
| SMILES | Cc1nonc1OCCNC(=O)CCC1CCCCN1C |
| InChI | InChI=1S/C14H24N4O3/c1-11-14(17-21-16-11)20-10-8-15-13(19)7-6-12-5-3-4-9-18(12)2/h12H,3-10H2,1-2H3,(H,15,19) |
| InChIKey | NPGDANDYTQCBKH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|