C20H21N7O — CID 122571443
4-[2-amino-6-(cyclopropylamino)pyrimidin-4-yl]-N-[(5-methylpyrazin-2-yl)methyl]benzamide (PubChem CID 122571443) has the molecular formula C20H21N7O and a molecular weight of 375.44 g/mol. Its IUPAC name is 4-[2-amino-6-(cyclopropylamino)pyrimidin-4-yl]-N-[(5-methylpyrazin-2-yl)methyl]benzamide.
| Compound Name | 4-[2-amino-6-(cyclopropylamino)pyrimidin-4-yl]-N-[(5-methylpyrazin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 122571443 |
| Molecular Formula | C20H21N7O |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 4-[2-amino-6-(cyclopropylamino)pyrimidin-4-yl]-N-[(5-methylpyrazin-2-yl)methyl]benzamide |
| SMILES | Cc1cnc(CNC(=O)c2ccc(-c3cc(NC4CC4)nc(N)n3)cc2)cn1 |
| InChI | InChI=1S/C20H21N7O/c1-12-9-23-16(10-22-12)11-24-19(28)14-4-2-13(3-5-14)17-8-18(25-15-6-7-15)27-20(21)26-17/h2-5,8-10,15H,6-7,11H2,1H3,(H,24,28)(H3,21,25,26,27) |
| InChIKey | VQMMBDIQPUOQGX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |