C15H16N3O3S- — CID 7080805
(1R,6R)-6-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methylcarbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 7080805) has the molecular formula C15H16N3O3S- and a molecular weight of 318.38 g/mol. Its IUPAC name is (1R,6R)-6-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methylcarbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1R,6R)-6-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methylcarbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7080805 |
| Molecular Formula | C15H16N3O3S- |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (1R,6R)-6-[(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methylcarbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | Cc1csc2nc(CNC(=O)[C@@H]3CC=CC[C@H]3C(=O)[O-])cn12 |
| InChI | InChI=1S/C15H17N3O3S/c1-9-8-22-15-17-10(7-18(9)15)6-16-13(19)11-4-2-3-5-12(11)14(20)21/h2-3,7-8,11-12H,4-6H2,1H3,(H,16,19)(H,20,21)/p-1/t11-,12-/m1/s1 |
| InChIKey | JNWQGDIZBYYIHC-VXGBXAGGSA-M |
| XLogP | 0.65 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|