C15H14Cl2NO3- — CID 4744977
6-[(3,4-dichlorophenyl)methylcarbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 4744977) has the molecular formula C15H14Cl2NO3- and a molecular weight of 327.19 g/mol. Its IUPAC name is 6-[(3,4-dichlorophenyl)methylcarbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | 6-[(3,4-dichlorophenyl)methylcarbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 4744977 |
| Molecular Formula | C15H14Cl2NO3- |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 6-[(3,4-dichlorophenyl)methylcarbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | O=C([O-])C1CC=CCC1C(=O)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H15Cl2NO3/c16-12-6-5-9(7-13(12)17)8-18-14(19)10-3-1-2-4-11(10)15(20)21/h1-2,5-7,10-11H,3-4,8H2,(H,18,19)(H,20,21)/p-1 |
| InChIKey | FVUAQZYJHCRJGO-UHFFFAOYSA-M |
| XLogP | 1.94 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|