C24H28N2O4 — CID 88882210
6-formyl-N-[[3-[[(6-formylcyclohex-3-ene-1-carbonyl)amino]methyl]phenyl]methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 88882210) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 6-formyl-N-[[3-[[(6-formylcyclohex-3-ene-1-carbonyl)amino]methyl]phenyl]methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | 6-formyl-N-[[3-[[(6-formylcyclohex-3-ene-1-carbonyl)amino]methyl]phenyl]methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 88882210 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 6-formyl-N-[[3-[[(6-formylcyclohex-3-ene-1-carbonyl)amino]methyl]phenyl]methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=CC1CC=CCC1C(=O)NCc1cccc(CNC(=O)C2CC=CCC2C=O)c1 |
| InChI | InChI=1S/C24H28N2O4/c27-15-19-8-1-3-10-21(19)23(29)25-13-17-6-5-7-18(12-17)14-26-24(30)22-11-4-2-9-20(22)16-28/h1-7,12,15-16,19-22H,8-11,13-14H2,(H,25,29)(H,26,30) |
| InChIKey | QLLUWPHOJDZAGN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|