C20H22N2O2 — CID 167936736
(1S,6R)-6-amino-N-[(3-phenoxyphenyl)methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 167936736) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (1S,6R)-6-amino-N-[(3-phenoxyphenyl)methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S,6R)-6-amino-N-[(3-phenoxyphenyl)methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 167936736 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (1S,6R)-6-amino-N-[(3-phenoxyphenyl)methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | N[C@@H]1CC=CC[C@@H]1C(=O)NCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H22N2O2/c21-19-12-5-4-11-18(19)20(23)22-14-15-7-6-10-17(13-15)24-16-8-2-1-3-9-16/h1-10,13,18-19H,11-12,14,21H2,(H,22,23)/t18-,19+/m0/s1 |
| InChIKey | GHGOSVOVWJTPDI-RBUKOAKNSA-N |
| XLogP | 3.39 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|