C16H22N2O — CID 101368590
(1R,4Z,8S)-8-amino-N-benzylcyclooct-4-ene-1-carboxamide (PubChem CID 101368590) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is (1R,4Z,8S)-8-amino-N-benzylcyclooct-4-ene-1-carboxamide.
| Compound Name | (1R,4Z,8S)-8-amino-N-benzylcyclooct-4-ene-1-carboxamide |
|---|---|
| PubChem CID | 101368590 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (1R,4Z,8S)-8-amino-N-benzylcyclooct-4-ene-1-carboxamide |
| SMILES | N[C@H]1CC/C=C\CC[C@H]1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C16H22N2O/c17-15-11-7-2-1-6-10-14(15)16(19)18-12-13-8-4-3-5-9-13/h1-5,8-9,14-15H,6-7,10-12,17H2,(H,18,19)/b2-1-/t14-,15+/m1/s1 |
| InChIKey | CSHMUSUEBCAYAC-PGGLMVFNSA-N |
| XLogP | 2.38 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|