C14H17NO — CID 134888481
N-benzylcyclohex-2-ene-1-carboxamide (PubChem CID 134888481) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is N-benzylcyclohex-2-ene-1-carboxamide.
| Compound Name | N-benzylcyclohex-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 134888481 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-benzylcyclohex-2-ene-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1C=CCCC1 |
| InChI | InChI=1S/C14H17NO/c16-14(13-9-5-2-6-10-13)15-11-12-7-3-1-4-8-12/h1,3-5,7-9,13H,2,6,10-11H2,(H,15,16) |
| InChIKey | CLZMNFHUVPCKSW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|